C30H28ClN3O5S — CID 4979501
3-[[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-1-methyl-5-morpholin-4-ylsulfonylindol-2-one (PubChem CID 4979501) has the molecular formula C30H28ClN3O5S and a molecular weight of 578.09 g/mol. Its IUPAC name is 3-[[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-1-methyl-5-morpholin-4-ylsulfonylindol-2-one.
| Compound Name | 3-[[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-1-methyl-5-morpholin-4-ylsulfonylindol-2-one |
|---|---|
| PubChem CID | 4979501 |
| Molecular Formula | C30H28ClN3O5S |
| Molecular Weight | 578.09 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | 3-[[1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-1-methyl-5-morpholin-4-ylsulfonylindol-2-one |
| SMILES | CN1C(=O)C(=Cc2cn(CCOc3ccccc3Cl)c3ccccc23)c2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C30H28ClN3O5S/c1-32-27-11-10-22(40(36,37)34-13-15-38-16-14-34)19-24(27)25(30(32)35)18-21-20-33(28-8-4-2-6-23(21)28)12-17-39-29-9-5-3-7-26(29)31/h2-11,18-20H,12-17H2,1H3 |
| InChIKey | OKNFQBAHVDSWMY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.09 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|