C29H32N4O6S — CID 4979827
1-ethyl-3-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one (PubChem CID 4979827) has the molecular formula C29H32N4O6S and a molecular weight of 564.66 g/mol. Its IUPAC name is 1-ethyl-3-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one.
| Compound Name | 1-ethyl-3-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one |
|---|---|
| PubChem CID | 4979827 |
| Molecular Formula | C29H32N4O6S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 1-ethyl-3-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one |
| SMILES | CCN1C(=O)C(=Cc2cn(CC(=O)N3CCOCC3)c3ccccc23)c2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C29H32N4O6S/c1-2-33-27-8-7-22(40(36,37)32-11-15-39-16-12-32)18-24(27)25(29(33)35)17-21-19-31(26-6-4-3-5-23(21)26)20-28(34)30-9-13-38-14-10-30/h3-8,17-19H,2,9-16,20H2,1H3 |
| InChIKey | PEZWDQKYIVKLMM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 101.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|