C35H39N3O5S — CID 6239464
(3Z)-1-ethyl-3-[[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one (PubChem CID 6239464) has the molecular formula C35H39N3O5S and a molecular weight of 613.78 g/mol. Its IUPAC name is (3Z)-1-ethyl-3-[[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one.
| Compound Name | (3Z)-1-ethyl-3-[[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one |
|---|---|
| PubChem CID | 6239464 |
| Molecular Formula | C35H39N3O5S |
| Molecular Weight | 613.78 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | (3Z)-1-ethyl-3-[[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one |
| SMILES | CCN1C(=O)/C(=C\c2cn(CCOc3cc(C)ccc3C(C)C)c3ccccc23)c2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C35H39N3O5S/c1-5-38-33-13-11-27(44(40,41)37-15-17-42-18-16-37)22-30(33)31(35(38)39)21-26-23-36(32-9-7-6-8-29(26)32)14-19-43-34-20-25(4)10-12-28(34)24(2)3/h6-13,20-24H,5,14-19H2,1-4H3/b31-21- |
| InChIKey | JQZDMAVTBQPZFH-YQYKVWLJSA-N |
| XLogP | 6.08 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.78 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|