C31H32N2O2 — CID 126210887
(3E)-1-ethyl-3-[[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]indol-2-one (PubChem CID 126210887) has the molecular formula C31H32N2O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is (3E)-1-ethyl-3-[[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]indol-2-one.
| Compound Name | (3E)-1-ethyl-3-[[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]indol-2-one |
|---|---|
| PubChem CID | 126210887 |
| Molecular Formula | C31H32N2O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | (3E)-1-ethyl-3-[[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]indol-2-one |
| SMILES | CCN1C(=O)/C(=C/c2cn(CCOc3cc(C)ccc3C(C)C)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C31H32N2O2/c1-5-33-29-13-9-7-11-26(29)27(31(33)34)19-23-20-32(28-12-8-6-10-25(23)28)16-17-35-30-18-22(4)14-15-24(30)21(2)3/h6-15,18-21H,5,16-17H2,1-4H3/b27-19+ |
| InChIKey | JIBNCFRFMDUDKE-ZXVVBBHZSA-N |
| XLogP | 7.06 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|