C26H32N2OS — CID 1281079
[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]-piperidin-1-ylmethanethione (PubChem CID 1281079) has the molecular formula C26H32N2OS and a molecular weight of 420.62 g/mol. Its IUPAC name is [1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]-piperidin-1-ylmethanethione.
| Compound Name | [1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]-piperidin-1-ylmethanethione |
|---|---|
| PubChem CID | 1281079 |
| Molecular Formula | C26H32N2OS |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | [1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]-piperidin-1-ylmethanethione |
| SMILES | Cc1ccc(C(C)C)c(OCCn2cc(C(=S)N3CCCCC3)c3ccccc32)c1 |
| InChI | InChI=1S/C26H32N2OS/c1-19(2)21-12-11-20(3)17-25(21)29-16-15-28-18-23(22-9-5-6-10-24(22)28)26(30)27-13-7-4-8-14-27/h5-6,9-12,17-19H,4,7-8,13-16H2,1-3H3 |
| InChIKey | HDFJTJIVNVDRAT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|