C30H28FN3O2 — CID 71833235
2-cyano-N-(4-fluorophenyl)-3-[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]prop-2-enamide (PubChem CID 71833235) has the molecular formula C30H28FN3O2 and a molecular weight of 481.57 g/mol. Its IUPAC name is 2-cyano-N-(4-fluorophenyl)-3-[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(4-fluorophenyl)-3-[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 71833235 |
| Molecular Formula | C30H28FN3O2 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 2-cyano-N-(4-fluorophenyl)-3-[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]indol-3-yl]prop-2-enamide |
| SMILES | Cc1ccc(C(C)C)c(OCCn2cc(C=C(C#N)C(=O)Nc3ccc(F)cc3)c3ccccc32)c1 |
| InChI | InChI=1S/C30H28FN3O2/c1-20(2)26-13-8-21(3)16-29(26)36-15-14-34-19-23(27-6-4-5-7-28(27)34)17-22(18-32)30(35)33-25-11-9-24(31)10-12-25/h4-13,16-17,19-20H,14-15H2,1-3H3,(H,33,35) |
| InChIKey | ADMCABBKMYDYGK-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|