C30H29N3O2 — CID 21234325
(E)-2-cyano-3-[1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-N-(2,3-dimethylphenyl)prop-2-enamide (PubChem CID 21234325) has the molecular formula C30H29N3O2 and a molecular weight of 463.58 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-N-(2,3-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-N-(2,3-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 21234325 |
| Molecular Formula | C30H29N3O2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | (E)-2-cyano-3-[1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]-N-(2,3-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(C)c(OCCn2cc(/C=C(\C#N)C(=O)Nc3cccc(C)c3C)c3ccccc32)c1 |
| InChI | InChI=1S/C30H29N3O2/c1-20-12-13-22(3)29(16-20)35-15-14-33-19-25(26-9-5-6-11-28(26)33)17-24(18-31)30(34)32-27-10-7-8-21(2)23(27)4/h5-13,16-17,19H,14-15H2,1-4H3,(H,32,34)/b24-17+ |
| InChIKey | NWVACEKMLYUDQF-JJIBRWJFSA-N |
| XLogP | 6.50 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|