C21H17ClN4O2 — CID 4679744
3-[1-(2-amino-2-oxoethyl)indol-3-yl]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide (PubChem CID 4679744) has the molecular formula C21H17ClN4O2 and a molecular weight of 392.85 g/mol. Its IUPAC name is 3-[1-(2-amino-2-oxoethyl)indol-3-yl]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide.
| Compound Name | 3-[1-(2-amino-2-oxoethyl)indol-3-yl]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 4679744 |
| Molecular Formula | C21H17ClN4O2 |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 3-[1-(2-amino-2-oxoethyl)indol-3-yl]-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(C#N)=Cc1cn(CC(N)=O)c2ccccc12 |
| InChI | InChI=1S/C21H17ClN4O2/c1-13-17(22)6-4-7-18(13)25-21(28)14(10-23)9-15-11-26(12-20(24)27)19-8-3-2-5-16(15)19/h2-9,11H,12H2,1H3,(H2,24,27)(H,25,28) |
| InChIKey | RWIGNKARVLVHCB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|