C24H21ClN4O3 — CID 1279041
(Z)-N-(2-chlorophenyl)-2-cyano-3-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]prop-2-enamide (PubChem CID 1279041) has the molecular formula C24H21ClN4O3 and a molecular weight of 448.91 g/mol. Its IUPAC name is (Z)-N-(2-chlorophenyl)-2-cyano-3-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]prop-2-enamide.
| Compound Name | (Z)-N-(2-chlorophenyl)-2-cyano-3-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 1279041 |
| Molecular Formula | C24H21ClN4O3 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (Z)-N-(2-chlorophenyl)-2-cyano-3-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]prop-2-enamide |
| SMILES | N#C/C(=C/c1cn(CC(=O)N2CCOCC2)c2ccccc12)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C24H21ClN4O3/c25-20-6-2-3-7-21(20)27-24(31)17(14-26)13-18-15-29(22-8-4-1-5-19(18)22)16-23(30)28-9-11-32-12-10-28/h1-8,13,15H,9-12,16H2,(H,27,31)/b17-13- |
| InChIKey | ZCEPYDLBJPJAQD-LGMDPLHJSA-N |
| XLogP | 3.70 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|