C26H32N4O2 — CID 21234359
(E)-2-cyano-N-cycloheptyl-3-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]prop-2-enamide (PubChem CID 21234359) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is (E)-2-cyano-N-cycloheptyl-3-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-cycloheptyl-3-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 21234359 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (E)-2-cyano-N-cycloheptyl-3-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cn(CC(=O)N2CCCCC2)c2ccccc12)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C26H32N4O2/c27-17-20(26(32)28-22-10-4-1-2-5-11-22)16-21-18-30(24-13-7-6-12-23(21)24)19-25(31)29-14-8-3-9-15-29/h6-7,12-13,16,18,22H,1-5,8-11,14-15,19H2,(H,28,32)/b20-16+ |
| InChIKey | OELAMROMKNHZGF-CAPFRKAQSA-N |
| XLogP | 4.40 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|