C24H28N4O3 — CID 21234357
(E)-2-cyano-N-(oxolan-2-ylmethyl)-3-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]prop-2-enamide (PubChem CID 21234357) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is (E)-2-cyano-N-(oxolan-2-ylmethyl)-3-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(oxolan-2-ylmethyl)-3-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 21234357 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (E)-2-cyano-N-(oxolan-2-ylmethyl)-3-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cn(CC(=O)N2CCCCC2)c2ccccc12)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C24H28N4O3/c25-14-18(24(30)26-15-20-7-6-12-31-20)13-19-16-28(22-9-3-2-8-21(19)22)17-23(29)27-10-4-1-5-11-27/h2-3,8-9,13,16,20H,1,4-7,10-12,15,17H2,(H,26,30)/b18-13+ |
| InChIKey | XLWXPVQPSGKNPU-QGOAFFKASA-N |
| XLogP | 2.86 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|