C26H32N4O3 — CID 126203297
(E)-2-cyano-3-[1-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]prop-2-enamide (PubChem CID 126203297) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 126203297 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (E)-2-cyano-3-[1-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]prop-2-enamide |
| SMILES | C[C@@H]1CCC[C@@H](C)N1C(=O)Cn1cc(/C=C(\C#N)C(=O)NC[C@@H]2CCCO2)c2ccccc21 |
| InChI | InChI=1S/C26H32N4O3/c1-18-7-5-8-19(2)30(18)25(31)17-29-16-21(23-10-3-4-11-24(23)29)13-20(14-27)26(32)28-15-22-9-6-12-33-22/h3-4,10-11,13,16,18-19,22H,5-9,12,15,17H2,1-2H3,(H,28,32)/b20-13+/t18-,19-,22+/m1/s1 |
| InChIKey | VGDMVCNHDVQCJG-YLBMQYERSA-N |
| XLogP | 3.63 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|