C24H21ClFN3O2 — CID 126212174
(E)-3-[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide (PubChem CID 126212174) has the molecular formula C24H21ClFN3O2 and a molecular weight of 437.90 g/mol. Its IUPAC name is (E)-3-[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 126212174 |
| Molecular Formula | C24H21ClFN3O2 |
| Molecular Weight | 437.90 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (E)-3-[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cn(Cc2c(F)cccc2Cl)c2ccccc12)C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C24H21ClFN3O2/c25-21-7-3-8-22(26)20(21)15-29-14-17(19-6-1-2-9-23(19)29)11-16(12-27)24(30)28-13-18-5-4-10-31-18/h1-3,6-9,11,14,18H,4-5,10,13,15H2,(H,28,30)/b16-11+/t18-/m1/s1 |
| InChIKey | SDEGVJNTPRAFIH-QIPHDZALSA-N |
| XLogP | 4.68 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.90 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|