C26H27N3O3 — CID 27868432
(E)-2-cyano-3-[1-[2-(2-methylphenoxy)ethyl]indol-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]prop-2-enamide (PubChem CID 27868432) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-[2-(2-methylphenoxy)ethyl]indol-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-[2-(2-methylphenoxy)ethyl]indol-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 27868432 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (E)-2-cyano-3-[1-[2-(2-methylphenoxy)ethyl]indol-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]prop-2-enamide |
| SMILES | Cc1ccccc1OCCn1cc(/C=C(\C#N)C(=O)NC[C@@H]2CCCO2)c2ccccc21 |
| InChI | InChI=1S/C26H27N3O3/c1-19-7-2-5-11-25(19)32-14-12-29-18-21(23-9-3-4-10-24(23)29)15-20(16-27)26(30)28-17-22-8-6-13-31-22/h2-5,7,9-11,15,18,22H,6,8,12-14,17H2,1H3,(H,28,30)/b20-15+/t22-/m0/s1 |
| InChIKey | WQZCTGHENMNKEA-QDUHJBTASA-N |
| XLogP | 4.23 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|