C25H25N3O2 — CID 3142047
2-cyano-N-cyclopropyl-3-[1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]prop-2-enamide (PubChem CID 3142047) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-cyano-N-cyclopropyl-3-[1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-cyclopropyl-3-[1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3142047 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2-cyano-N-cyclopropyl-3-[1-[2-(2,5-dimethylphenoxy)ethyl]indol-3-yl]prop-2-enamide |
| SMILES | Cc1ccc(C)c(OCCn2cc(C=C(C#N)C(=O)NC3CC3)c3ccccc32)c1 |
| InChI | InChI=1S/C25H25N3O2/c1-17-7-8-18(2)24(13-17)30-12-11-28-16-20(22-5-3-4-6-23(22)28)14-19(15-26)25(29)27-21-9-10-21/h3-8,13-14,16,21H,9-12H2,1-2H3,(H,27,29) |
| InChIKey | DDGSWCNEPQXCGP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|