C25H29BrN4O3 — CID 126213817
(E)-3-[1-[2-(azepan-1-yl)-2-oxoethyl]-5-bromoindol-3-yl]-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide (PubChem CID 126213817) has the molecular formula C25H29BrN4O3 and a molecular weight of 513.44 g/mol. Its IUPAC name is (E)-3-[1-[2-(azepan-1-yl)-2-oxoethyl]-5-bromoindol-3-yl]-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[1-[2-(azepan-1-yl)-2-oxoethyl]-5-bromoindol-3-yl]-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 126213817 |
| Molecular Formula | C25H29BrN4O3 |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | (E)-3-[1-[2-(azepan-1-yl)-2-oxoethyl]-5-bromoindol-3-yl]-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cn(CC(=O)N2CCCCCC2)c2ccc(Br)cc12)C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C25H29BrN4O3/c26-20-7-8-23-22(13-20)19(12-18(14-27)25(32)28-15-21-6-5-11-33-21)16-30(23)17-24(31)29-9-3-1-2-4-10-29/h7-8,12-13,16,21H,1-6,9-11,15,17H2,(H,28,32)/b18-12+/t21-/m1/s1 |
| InChIKey | YLQCEXCNWRDRPU-MUPHDSPYSA-N |
| XLogP | 4.01 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|