C25H25BrN4O2S — CID 124540588
(E)-3-[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 124540588) has the molecular formula C25H25BrN4O2S and a molecular weight of 525.47 g/mol. Its IUPAC name is (E)-3-[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 124540588 |
| Molecular Formula | C25H25BrN4O2S |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | (E)-3-[5-bromo-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | C[C@H]1CCCCN1C(=O)Cn1cc(/C=C(\C#N)C(=O)NCc2cccs2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C25H25BrN4O2S/c1-17-5-2-3-9-30(17)24(31)16-29-15-19(22-12-20(26)7-8-23(22)29)11-18(13-27)25(32)28-14-21-6-4-10-33-21/h4,6-8,10-12,15,17H,2-3,5,9,14,16H2,1H3,(H,28,32)/b18-11+/t17-/m0/s1 |
| InChIKey | SUSSYYIKALTCMY-SZLZGVTBSA-N |
| XLogP | 5.09 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|