C23H25NO2 — CID 2213955
cyclopropyl-[1-[3-(2,5-dimethylphenoxy)propyl]indol-3-yl]methanone (PubChem CID 2213955) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is cyclopropyl-[1-[3-(2,5-dimethylphenoxy)propyl]indol-3-yl]methanone.
| Compound Name | cyclopropyl-[1-[3-(2,5-dimethylphenoxy)propyl]indol-3-yl]methanone |
|---|---|
| PubChem CID | 2213955 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | cyclopropyl-[1-[3-(2,5-dimethylphenoxy)propyl]indol-3-yl]methanone |
| SMILES | Cc1ccc(C)c(OCCCn2cc(C(=O)C3CC3)c3ccccc32)c1 |
| InChI | InChI=1S/C23H25NO2/c1-16-8-9-17(2)22(14-16)26-13-5-12-24-15-20(23(25)18-10-11-18)19-6-3-4-7-21(19)24/h3-4,6-9,14-15,18H,5,10-13H2,1-2H3 |
| InChIKey | MSSFHBXQIDOQGS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|