1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid

C20H21NO3 — CID 22332903

IUPAC1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid
SMILESCc1ccc(C)c(OCCCn2cc(C(=O)O)c3ccccc32)c1
InChIInChI=1S/C20H21NO3/c1-14-8-9-15(2)19(12-14)24-11-5-10-21-13-17(20(22)23)16-6-3-4-7-18(16)21/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H,22,23)
InChIKeyNNEUZPGBOOCIBI-UHFFFAOYSA-N
MW323.39 g/mol
LogP4.43
Rot. Bonds6

About 1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid

1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid (PubChem CID 22332903) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid.

Molecular Properties

Compound Name1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid
PubChem CID22332903
Molecular FormulaC20H21NO3
Molecular Weight323.39 g/mol
Exact Mass323.15
IUPAC Name1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid
SMILESCc1ccc(C)c(OCCCn2cc(C(=O)O)c3ccccc32)c1
InChIInChI=1S/C20H21NO3/c1-14-8-9-15(2)19(12-14)24-11-5-10-21-13-17(20(22)23)16-6-3-4-7-18(16)21/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H,22,23)
InChIKeyNNEUZPGBOOCIBI-UHFFFAOYSA-N
XLogP4.43
TPSA51.46 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500323.39
LogP ≤ 54.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid?
The IUPAC name of 1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid (CID 22332903) is 1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid.
What is the SMILES notation for 1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid?
The canonical SMILES for 1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid is Cc1ccc(C)c(OCCCn2cc(C(=O)O)c3ccccc32)c1.
What is the InChIKey of 1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid?
The InChIKey is NNEUZPGBOOCIBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO3/c1-14-8-9-15(2)19(12-14)24-11-5-10-21-13-17(20(22)23)16-6-3-4-7-18(16)21/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H,22,23).
What are the key properties of 1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid?
1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid has a molecular weight of 323.39 g/mol, XLogP of 4.43, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid is sourced from PubChem (CID 22332903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).