C20H21NO3 — CID 22332903
1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid (PubChem CID 22332903) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid.
| Compound Name | 1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 22332903 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-[3-(2,5-dimethylphenoxy)propyl]indole-3-carboxylic acid |
| SMILES | Cc1ccc(C)c(OCCCn2cc(C(=O)O)c3ccccc32)c1 |
| InChI | InChI=1S/C20H21NO3/c1-14-8-9-15(2)19(12-14)24-11-5-10-21-13-17(20(22)23)16-6-3-4-7-18(16)21/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H,22,23) |
| InChIKey | NNEUZPGBOOCIBI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|