C20H21NO2 — CID 21380760
2-(2,5-dimethylphenoxy)-1-(1-ethylindol-3-yl)ethanone (PubChem CID 21380760) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-1-(1-ethylindol-3-yl)ethanone.
| Compound Name | 2-(2,5-dimethylphenoxy)-1-(1-ethylindol-3-yl)ethanone |
|---|---|
| PubChem CID | 21380760 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-1-(1-ethylindol-3-yl)ethanone |
| SMILES | CCn1cc(C(=O)COc2cc(C)ccc2C)c2ccccc21 |
| InChI | InChI=1S/C20H21NO2/c1-4-21-12-17(16-7-5-6-8-18(16)21)19(22)13-23-20-11-14(2)9-10-15(20)3/h5-12H,4,13H2,1-3H3 |
| InChIKey | VLKZWIXPLFLBRL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |