C23H17ClN2O4 — CID 55312171
3-[3-[2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]indol-1-yl]propanenitrile (PubChem CID 55312171) has the molecular formula C23H17ClN2O4 and a molecular weight of 420.85 g/mol. Its IUPAC name is 3-[3-[2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 55312171 |
| Molecular Formula | C23H17ClN2O4 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 3-[3-[2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]indol-1-yl]propanenitrile |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)c3cn(CCC#N)c4ccccc34)c(Cl)cc12 |
| InChI | InChI=1S/C23H17ClN2O4/c1-14-9-23(28)30-21-11-22(18(24)10-16(14)21)29-13-20(27)17-12-26(8-4-7-25)19-6-3-2-5-15(17)19/h2-3,5-6,9-12H,4,8,13H2,1H3 |
| InChIKey | PRSQYJVRNUGIOE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 85.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|