C25H23NO3 — CID 91864527
5-[3-(4-methylnaphthalene-1-carbonyl)indol-1-yl]pentanoic acid (PubChem CID 91864527) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 5-[3-(4-methylnaphthalene-1-carbonyl)indol-1-yl]pentanoic acid.
| Compound Name | 5-[3-(4-methylnaphthalene-1-carbonyl)indol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 91864527 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 5-[3-(4-methylnaphthalene-1-carbonyl)indol-1-yl]pentanoic acid |
| SMILES | Cc1ccc(C(=O)c2cn(CCCCC(=O)O)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C25H23NO3/c1-17-13-14-21(19-9-3-2-8-18(17)19)25(29)22-16-26(15-7-6-12-24(27)28)23-11-5-4-10-20(22)23/h2-5,8-11,13-14,16H,6-7,12,15H2,1H3,(H,27,28) |
| InChIKey | CXHVTSVFMMQERU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|