C18H24N2O4 — CID 119219776
6-[[1-(2-methoxyethyl)indole-3-carbonyl]amino]hexanoic acid (PubChem CID 119219776) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 6-[[1-(2-methoxyethyl)indole-3-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[1-(2-methoxyethyl)indole-3-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119219776 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 6-[[1-(2-methoxyethyl)indole-3-carbonyl]amino]hexanoic acid |
| SMILES | COCCn1cc(C(=O)NCCCCCC(=O)O)c2ccccc21 |
| InChI | InChI=1S/C18H24N2O4/c1-24-12-11-20-13-15(14-7-4-5-8-16(14)20)18(23)19-10-6-2-3-9-17(21)22/h4-5,7-8,13H,2-3,6,9-12H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | FLGCYIWDXMLGBW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|