C19H26N2O4 — CID 119190099
3-[[1-(2-methoxyethyl)indole-3-carbonyl]-(2-methylpropyl)amino]propanoic acid (PubChem CID 119190099) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-[[1-(2-methoxyethyl)indole-3-carbonyl]-(2-methylpropyl)amino]propanoic acid.
| Compound Name | 3-[[1-(2-methoxyethyl)indole-3-carbonyl]-(2-methylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119190099 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-[[1-(2-methoxyethyl)indole-3-carbonyl]-(2-methylpropyl)amino]propanoic acid |
| SMILES | COCCn1cc(C(=O)N(CCC(=O)O)CC(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H26N2O4/c1-14(2)12-21(9-8-18(22)23)19(24)16-13-20(10-11-25-3)17-7-5-4-6-15(16)17/h4-7,13-14H,8-12H2,1-3H3,(H,22,23) |
| InChIKey | OMVINLFHWKBBLV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |