C20H21N3O3 — CID 175130499
5-[[1-(pyridin-2-ylmethyl)indole-3-carbonyl]amino]pentanoic acid (PubChem CID 175130499) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 5-[[1-(pyridin-2-ylmethyl)indole-3-carbonyl]amino]pentanoic acid.
| Compound Name | 5-[[1-(pyridin-2-ylmethyl)indole-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 175130499 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 5-[[1-(pyridin-2-ylmethyl)indole-3-carbonyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)c1cn(Cc2ccccn2)c2ccccc12 |
| InChI | InChI=1S/C20H21N3O3/c24-19(25)10-4-6-12-22-20(26)17-14-23(13-15-7-3-5-11-21-15)18-9-2-1-8-16(17)18/h1-3,5,7-9,11,14H,4,6,10,12-13H2,(H,22,26)(H,24,25) |
| InChIKey | CSFOGFLXAYQSCD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|