C23H25NO2S — CID 22684330
2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]naphthalene-1-carbothioamide (PubChem CID 22684330) has the molecular formula C23H25NO2S and a molecular weight of 379.53 g/mol. Its IUPAC name is 2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]naphthalene-1-carbothioamide.
| Compound Name | 2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]naphthalene-1-carbothioamide |
|---|---|
| PubChem CID | 22684330 |
| Molecular Formula | C23H25NO2S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]naphthalene-1-carbothioamide |
| SMILES | Cc1ccc(C(C)C)c(OCCOc2ccc3ccccc3c2C(N)=S)c1 |
| InChI | InChI=1S/C23H25NO2S/c1-15(2)18-10-8-16(3)14-21(18)26-13-12-25-20-11-9-17-6-4-5-7-19(17)22(20)23(24)27/h4-11,14-15H,12-13H2,1-3H3,(H2,24,27) |
| InChIKey | FMJSXLRBVQTWHT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|