C19H15Cl2NO2S — CID 22680823
2-[2-(2,4-dichlorophenoxy)ethoxy]naphthalene-1-carbothioamide (PubChem CID 22680823) has the molecular formula C19H15Cl2NO2S and a molecular weight of 392.31 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenoxy)ethoxy]naphthalene-1-carbothioamide.
| Compound Name | 2-[2-(2,4-dichlorophenoxy)ethoxy]naphthalene-1-carbothioamide |
|---|---|
| PubChem CID | 22680823 |
| Molecular Formula | C19H15Cl2NO2S |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 2-[2-(2,4-dichlorophenoxy)ethoxy]naphthalene-1-carbothioamide |
| SMILES | NC(=S)c1c(OCCOc2ccc(Cl)cc2Cl)ccc2ccccc12 |
| InChI | InChI=1S/C19H15Cl2NO2S/c20-13-6-8-16(15(21)11-13)23-9-10-24-17-7-5-12-3-1-2-4-14(12)18(17)19(22)25/h1-8,11H,9-10H2,(H2,22,25) |
| InChIKey | ZNLXVCSXCJKSCM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|