C21H18Cl2O4 — CID 70542007
5-(2,4-dichlorophenoxy)-2-hydroxy-3-naphthalen-1-ylpentanoic acid (PubChem CID 70542007) has the molecular formula C21H18Cl2O4 and a molecular weight of 405.28 g/mol. Its IUPAC name is 5-(2,4-dichlorophenoxy)-2-hydroxy-3-naphthalen-1-ylpentanoic acid.
| Compound Name | 5-(2,4-dichlorophenoxy)-2-hydroxy-3-naphthalen-1-ylpentanoic acid |
|---|---|
| PubChem CID | 70542007 |
| Molecular Formula | C21H18Cl2O4 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 5-(2,4-dichlorophenoxy)-2-hydroxy-3-naphthalen-1-ylpentanoic acid |
| SMILES | O=C(O)C(O)C(CCOc1ccc(Cl)cc1Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H18Cl2O4/c22-14-8-9-19(18(23)12-14)27-11-10-17(20(24)21(25)26)16-7-3-5-13-4-1-2-6-15(13)16/h1-9,12,17,20,24H,10-11H2,(H,25,26) |
| InChIKey | RJAZYOHNAHGFJR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |