C22H19Cl2NO3 — CID 3374858
N-[2-(2,4-dichlorophenoxy)ethyl]-2-phenoxy-N-phenylacetamide (PubChem CID 3374858) has the molecular formula C22H19Cl2NO3 and a molecular weight of 416.30 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenoxy)ethyl]-2-phenoxy-N-phenylacetamide.
| Compound Name | N-[2-(2,4-dichlorophenoxy)ethyl]-2-phenoxy-N-phenylacetamide |
|---|---|
| PubChem CID | 3374858 |
| Molecular Formula | C22H19Cl2NO3 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | N-[2-(2,4-dichlorophenoxy)ethyl]-2-phenoxy-N-phenylacetamide |
| SMILES | O=C(COc1ccccc1)N(CCOc1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H19Cl2NO3/c23-17-11-12-21(20(24)15-17)27-14-13-25(18-7-3-1-4-8-18)22(26)16-28-19-9-5-2-6-10-19/h1-12,15H,13-14,16H2 |
| InChIKey | KZKLAZOGGLVEQP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |