C20H14Cl2N2O4 — CID 3303269
2-(2,4-dichlorophenoxy)-N-(2-nitrophenyl)-N-phenylacetamide (PubChem CID 3303269) has the molecular formula C20H14Cl2N2O4 and a molecular weight of 417.25 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(2-nitrophenyl)-N-phenylacetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(2-nitrophenyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 3303269 |
| Molecular Formula | C20H14Cl2N2O4 |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(2-nitrophenyl)-N-phenylacetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N(c1ccccc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H14Cl2N2O4/c21-14-10-11-19(16(22)12-14)28-13-20(25)23(15-6-2-1-3-7-15)17-8-4-5-9-18(17)24(26)27/h1-12H,13H2 |
| InChIKey | FAWCNRLUSCBSGQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|