C14H11Cl2N3O4 — CID 22311389
N-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-phenylnitramide (PubChem CID 22311389) has the molecular formula C14H11Cl2N3O4 and a molecular weight of 356.17 g/mol. Its IUPAC name is N-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-phenylnitramide.
| Compound Name | N-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-phenylnitramide |
|---|---|
| PubChem CID | 22311389 |
| Molecular Formula | C14H11Cl2N3O4 |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | N-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-phenylnitramide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NN(c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C14H11Cl2N3O4/c15-10-6-7-13(12(16)8-10)23-9-14(20)17-18(19(21)22)11-4-2-1-3-5-11/h1-8H,9H2,(H,17,20) |
| InChIKey | PABXNCSDHLEPON-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|