C18H16Cl2O3 — CID 59520440
6-(2,4-dichlorophenoxy)-1-phenylhexane-1,3-dione (PubChem CID 59520440) has the molecular formula C18H16Cl2O3 and a molecular weight of 351.23 g/mol. Its IUPAC name is 6-(2,4-dichlorophenoxy)-1-phenylhexane-1,3-dione.
| Compound Name | 6-(2,4-dichlorophenoxy)-1-phenylhexane-1,3-dione |
|---|---|
| PubChem CID | 59520440 |
| Molecular Formula | C18H16Cl2O3 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 6-(2,4-dichlorophenoxy)-1-phenylhexane-1,3-dione |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16Cl2O3/c19-14-8-9-18(16(20)11-14)23-10-4-7-15(21)12-17(22)13-5-2-1-3-6-13/h1-3,5-6,8-9,11H,4,7,10,12H2 |
| InChIKey | NFPSSFRYHLELDG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|