About 5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one
5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one (PubChem CID 87753757) has the molecular formula C29H25Cl2O2P
and a molecular weight of 507.40 g/mol. Its IUPAC name is 5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one.
Molecular Properties
| Compound Name | 5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one |
| PubChem CID | 87753757 |
| Molecular Formula | C29H25Cl2O2P |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)Cc1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H25Cl2O2P/c30-23-17-18-28(27(31)21-23)33-19-9-11-24(32)20-22-10-7-8-16-29(22)34(25-12-3-1-4-13-25)26-14-5-2-6-15-26/h1-8,10,12-18,21H,9,11,19-20H2 |
| InChIKey | IHHHKBGLVAXJHX-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one?
The IUPAC name of 5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one (CID 87753757) is 5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one.
What is the SMILES notation for 5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one?
The canonical SMILES for 5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one is O=C(CCCOc1ccc(Cl)cc1Cl)Cc1ccccc1P(c1ccccc1)c1ccccc1.
What is the InChIKey of 5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one?
The InChIKey is IHHHKBGLVAXJHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H25Cl2O2P/c30-23-17-18-28(27(31)21-23)33-19-9-11-24(32)20-22-10-7-8-16-29(22)34(25-12-3-1-4-13-25)26-14-5-2-6-15-26/h1-8,10,12-18,21H,9,11,19-20H2.
What are the key properties of 5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one?
5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one has a molecular weight of 507.40 g/mol, XLogP of 6.72, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dichlorophenoxy)-1-(2-diphenylphosphanylphenyl)pentan-2-one is sourced from PubChem (CID 87753757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).