C13H15Cl2N2O2- — CID 4564748
4-(2,4-dichlorophenoxy)-N-propan-2-ylidenebutanehydrazonate (PubChem CID 4564748) has the molecular formula C13H15Cl2N2O2- and a molecular weight of 302.18 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-propan-2-ylidenebutanehydrazonate.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-propan-2-ylidenebutanehydrazonate |
|---|---|
| PubChem CID | 4564748 |
| Molecular Formula | C13H15Cl2N2O2- |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-propan-2-ylidenebutanehydrazonate |
| SMILES | CC(C)=NN=C([O-])CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-9(2)16-17-13(18)4-3-7-19-12-6-5-10(14)8-11(12)15/h5-6,8H,3-4,7H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | DKBXICIPUUUIPV-UHFFFAOYSA-M |
| XLogP | 3.31 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|