C20H22Cl2O3 — CID 19184255
(2-tert-butylphenyl) 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 19184255) has the molecular formula C20H22Cl2O3 and a molecular weight of 381.30 g/mol. Its IUPAC name is (2-tert-butylphenyl) 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | (2-tert-butylphenyl) 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 19184255 |
| Molecular Formula | C20H22Cl2O3 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (2-tert-butylphenyl) 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | CC(C)(C)c1ccccc1OC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl2O3/c1-20(2,3)15-7-4-5-8-17(15)25-19(23)9-6-12-24-18-11-10-14(21)13-16(18)22/h4-5,7-8,10-11,13H,6,9,12H2,1-3H3 |
| InChIKey | FQIBGSMJSVDQEX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|