C18H19Cl2NO4S — CID 84559146
3-(thiophene-2-carbonylamino)propyl 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 84559146) has the molecular formula C18H19Cl2NO4S and a molecular weight of 416.33 g/mol. Its IUPAC name is 3-(thiophene-2-carbonylamino)propyl 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | 3-(thiophene-2-carbonylamino)propyl 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 84559146 |
| Molecular Formula | C18H19Cl2NO4S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 3-(thiophene-2-carbonylamino)propyl 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)OCCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C18H19Cl2NO4S/c19-13-6-7-15(14(20)12-13)24-9-1-5-17(22)25-10-3-8-21-18(23)16-4-2-11-26-16/h2,4,6-7,11-12H,1,3,5,8-10H2,(H,21,23) |
| InChIKey | BGAMMNUWGNQHBQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|