C16H16ClNO4S — CID 31741424
2-(2-chlorophenoxy)ethyl 3-(thiophene-2-carbonylamino)propanoate (PubChem CID 31741424) has the molecular formula C16H16ClNO4S and a molecular weight of 353.83 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)ethyl 3-(thiophene-2-carbonylamino)propanoate.
| Compound Name | 2-(2-chlorophenoxy)ethyl 3-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 31741424 |
| Molecular Formula | C16H16ClNO4S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 2-(2-chlorophenoxy)ethyl 3-(thiophene-2-carbonylamino)propanoate |
| SMILES | O=C(CCNC(=O)c1cccs1)OCCOc1ccccc1Cl |
| InChI | InChI=1S/C16H16ClNO4S/c17-12-4-1-2-5-13(12)21-9-10-22-15(19)7-8-18-16(20)14-6-3-11-23-14/h1-6,11H,7-10H2,(H,18,20) |
| InChIKey | OAISOOOZEVSYRY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|