C14H14F3N3O3S — CID 87033433
2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-(thiophene-2-carbonylamino)propanoate (PubChem CID 87033433) has the molecular formula C14H14F3N3O3S and a molecular weight of 361.35 g/mol. Its IUPAC name is 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-(thiophene-2-carbonylamino)propanoate.
| Compound Name | 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 87033433 |
| Molecular Formula | C14H14F3N3O3S |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-(thiophene-2-carbonylamino)propanoate |
| SMILES | O=C(CCNC(=O)c1cccs1)OCCc1cn[nH]c1C(F)(F)F |
| InChI | InChI=1S/C14H14F3N3O3S/c15-14(16,17)12-9(8-19-20-12)4-6-23-11(21)3-5-18-13(22)10-2-1-7-24-10/h1-2,7-8H,3-6H2,(H,18,22)(H,19,20) |
| InChIKey | VJXKLNDZAQLVNN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |