C11H9F3N2O3 — CID 47079536
2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl furan-2-carboxylate (PubChem CID 47079536) has the molecular formula C11H9F3N2O3 and a molecular weight of 274.20 g/mol. Its IUPAC name is 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl furan-2-carboxylate.
| Compound Name | 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl furan-2-carboxylate |
|---|---|
| PubChem CID | 47079536 |
| Molecular Formula | C11H9F3N2O3 |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl furan-2-carboxylate |
| SMILES | O=C(OCCc1cn[nH]c1C(F)(F)F)c1ccco1 |
| InChI | InChI=1S/C11H9F3N2O3/c12-11(13,14)9-7(6-15-16-9)3-5-19-10(17)8-2-1-4-18-8/h1-2,4,6H,3,5H2,(H,15,16) |
| InChIKey | HYSTVNTZBLPLIV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |