C7H8F3N3O4 — CID 118993591
oxalic acid;[5-(trifluoromethyl)-1H-pyrazol-4-yl]methanamine (PubChem CID 118993591) has the molecular formula C7H8F3N3O4 and a molecular weight of 255.15 g/mol. Its IUPAC name is oxalic acid;[5-(trifluoromethyl)-1H-pyrazol-4-yl]methanamine.
| Compound Name | oxalic acid;[5-(trifluoromethyl)-1H-pyrazol-4-yl]methanamine |
|---|---|
| PubChem CID | 118993591 |
| Molecular Formula | C7H8F3N3O4 |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | oxalic acid;[5-(trifluoromethyl)-1H-pyrazol-4-yl]methanamine |
| SMILES | NCc1cn[nH]c1C(F)(F)F.O=C(O)C(=O)O |
| InChI | InChI=1S/C5H6F3N3.C2H2O4/c6-5(7,8)4-3(1-9)2-10-11-4;3-1(4)2(5)6/h2H,1,9H2,(H,10,11);(H,3,4)(H,5,6) |
| InChIKey | ARSNFBADOBETOU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|