C18H21NO5S — CID 84559948
3-(thiophene-2-carbonylamino)propyl 2-(4-ethoxyphenoxy)acetate (PubChem CID 84559948) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-(thiophene-2-carbonylamino)propyl 2-(4-ethoxyphenoxy)acetate.
| Compound Name | 3-(thiophene-2-carbonylamino)propyl 2-(4-ethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 84559948 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 3-(thiophene-2-carbonylamino)propyl 2-(4-ethoxyphenoxy)acetate |
| SMILES | CCOc1ccc(OCC(=O)OCCCNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-2-22-14-6-8-15(9-7-14)24-13-17(20)23-11-4-10-19-18(21)16-5-3-12-25-16/h3,5-9,12H,2,4,10-11,13H2,1H3,(H,19,21) |
| InChIKey | CXPOENBKPKITST-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|