C18H19Cl2NO2 — CID 2838387
4-(2,4-dichlorophenoxy)-N-(2-ethylphenyl)butanamide (PubChem CID 2838387) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-(2-ethylphenyl)butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-(2-ethylphenyl)butanamide |
|---|---|
| PubChem CID | 2838387 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-(2-ethylphenyl)butanamide |
| SMILES | CCc1ccccc1NC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl2NO2/c1-2-13-6-3-4-7-16(13)21-18(22)8-5-11-23-17-10-9-14(19)12-15(17)20/h3-4,6-7,9-10,12H,2,5,8,11H2,1H3,(H,21,22) |
| InChIKey | NSQBKAJQDZADSP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|