C22H23NO2S — CID 22681366
2-[2-(2,3,6-trimethylphenoxy)ethoxy]naphthalene-1-carbothioamide (PubChem CID 22681366) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is 2-[2-(2,3,6-trimethylphenoxy)ethoxy]naphthalene-1-carbothioamide.
| Compound Name | 2-[2-(2,3,6-trimethylphenoxy)ethoxy]naphthalene-1-carbothioamide |
|---|---|
| PubChem CID | 22681366 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[2-(2,3,6-trimethylphenoxy)ethoxy]naphthalene-1-carbothioamide |
| SMILES | Cc1ccc(C)c(OCCOc2ccc3ccccc3c2C(N)=S)c1C |
| InChI | InChI=1S/C22H23NO2S/c1-14-8-9-15(2)21(16(14)3)25-13-12-24-19-11-10-17-6-4-5-7-18(17)20(19)22(23)26/h4-11H,12-13H2,1-3H3,(H2,23,26) |
| InChIKey | HUZGAAOZTAJPML-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|