C19H21ClN4O2S2 — CID 135882415
N-(3-chlorophenyl)-5-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135882415) has the molecular formula C19H21ClN4O2S2 and a molecular weight of 436.99 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-(3-chlorophenyl)-5-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135882415 |
| Molecular Formula | C19H21ClN4O2S2 |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | N-(3-chlorophenyl)-5-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Cc1cc(C2=NN/C(=N/c3cccc(Cl)c3)SC2)c(C)n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H21ClN4O2S2/c1-12-8-17(13(2)24(12)16-6-7-28(25,26)11-16)18-10-27-19(23-22-18)21-15-5-3-4-14(20)9-15/h3-5,8-9,16H,6-7,10-11H2,1-2H3,(H,21,23) |
| InChIKey | ORVZHWVGWMBMHF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|