C11H12Cl3N3S — CID 135800628
5-(2,4-dichlorophenyl)-N-ethyl-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrochloride (PubChem CID 135800628) has the molecular formula C11H12Cl3N3S and a molecular weight of 324.66 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-N-ethyl-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrochloride.
| Compound Name | 5-(2,4-dichlorophenyl)-N-ethyl-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrochloride |
|---|---|
| PubChem CID | 135800628 |
| Molecular Formula | C11H12Cl3N3S |
| Molecular Weight | 324.66 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-N-ethyl-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrochloride |
| SMILES | CC/N=C1/NN=C(c2ccc(Cl)cc2Cl)CS1.Cl |
| InChI | InChI=1S/C11H11Cl2N3S.ClH/c1-2-14-11-16-15-10(6-17-11)8-4-3-7(12)5-9(8)13;/h3-5H,2,6H2,1H3,(H,14,16);1H |
| InChIKey | QGSRPTVNXVZNLU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.66 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|