C21H18Cl2N4S — CID 135531819
N-(2,4-dichlorophenyl)-5-(2,5-dimethyl-1-phenylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135531819) has the molecular formula C21H18Cl2N4S and a molecular weight of 429.38 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-5-(2,5-dimethyl-1-phenylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-(2,4-dichlorophenyl)-5-(2,5-dimethyl-1-phenylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135531819 |
| Molecular Formula | C21H18Cl2N4S |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-(2,4-dichlorophenyl)-5-(2,5-dimethyl-1-phenylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Cc1cc(C2=NN/C(=N/c3ccc(Cl)cc3Cl)SC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C21H18Cl2N4S/c1-13-10-17(14(2)27(13)16-6-4-3-5-7-16)20-12-28-21(26-25-20)24-19-9-8-15(22)11-18(19)23/h3-11H,12H2,1-2H3,(H,24,26) |
| InChIKey | YXYDHHVAHPSYLD-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 41.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|