C19H24N4OS — CID 135473586
5-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-propan-2-yl-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135473586) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 5-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-propan-2-yl-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-propan-2-yl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135473586 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 5-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-propan-2-yl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | COc1ccc(-n2c(C)cc(C3=NN/C(=N/C(C)C)SC3)c2C)cc1 |
| InChI | InChI=1S/C19H24N4OS/c1-12(2)20-19-22-21-18(11-25-19)17-10-13(3)23(14(17)4)15-6-8-16(24-5)9-7-15/h6-10,12H,11H2,1-5H3,(H,20,22) |
| InChIKey | JKYSQZLNWJNTQB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|