C17H19N7S2 — CID 135877229
5-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-N-(2-thiophen-2-ylethyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135877229) has the molecular formula C17H19N7S2 and a molecular weight of 385.52 g/mol. Its IUPAC name is 5-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-N-(2-thiophen-2-ylethyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-N-(2-thiophen-2-ylethyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135877229 |
| Molecular Formula | C17H19N7S2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 5-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-N-(2-thiophen-2-ylethyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Cc1cc(C2=NN/C(=N/CCc3cccs3)SC2)c(C)n1-c1ncn[nH]1 |
| InChI | InChI=1S/C17H19N7S2/c1-11-8-14(12(2)24(11)16-19-10-20-22-16)15-9-26-17(23-21-15)18-6-5-13-4-3-7-25-13/h3-4,7-8,10H,5-6,9H2,1-2H3,(H,18,23)(H,19,20,22) |
| InChIKey | NRLCMQIZTMOWSH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|