C17H22N4OS — CID 135673038
5-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]-N-propyl-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135673038) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is 5-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]-N-propyl-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]-N-propyl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135673038 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 5-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]-N-propyl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | CCC/N=C1/NN=C(c2cc(C)n(Cc3ccco3)c2C)CS1 |
| InChI | InChI=1S/C17H22N4OS/c1-4-7-18-17-20-19-16(11-23-17)15-9-12(2)21(13(15)3)10-14-6-5-8-22-14/h5-6,8-9H,4,7,10-11H2,1-3H3,(H,18,20) |
| InChIKey | OPUMQKUBGMBLDJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|