C13H16BrN3S — CID 135672863
5-(3-bromophenyl)-N-butyl-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135672863) has the molecular formula C13H16BrN3S and a molecular weight of 326.26 g/mol. Its IUPAC name is 5-(3-bromophenyl)-N-butyl-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-(3-bromophenyl)-N-butyl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135672863 |
| Molecular Formula | C13H16BrN3S |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 5-(3-bromophenyl)-N-butyl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | CCCC/N=C1/NN=C(c2cccc(Br)c2)CS1 |
| InChI | InChI=1S/C13H16BrN3S/c1-2-3-7-15-13-17-16-12(9-18-13)10-5-4-6-11(14)8-10/h4-6,8H,2-3,7,9H2,1H3,(H,15,17) |
| InChIKey | CXJCDJFOTJBCRR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|